C29H30O5 — CID 11396973
[(1R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)cyclohex-2-en-1-yl] acetate (PubChem CID 11396973) has the molecular formula C29H30O5 and a molecular weight of 458.55 g/mol. Its IUPAC name is [(1R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11396973 |
| Molecular Formula | C29H30O5 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [(1R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)cyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CC(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H30O5/c1-22(30)34-27-18-17-26(31-19-23-11-5-2-6-12-23)28(32-20-24-13-7-3-8-14-24)29(27)33-21-25-15-9-4-10-16-25/h2-18,26-29H,19-21H2,1H3/t26?,27-,28+,29+/m1/s1 |
| InChIKey | KAVAATHSOIWFKJ-FDYVXIQZSA-N |
| XLogP | 5.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|