C20H24O7 — CID 102125512
ethyl (1S,4S,5R,6R)-4,6-diacetyloxy-5-phenylmethoxycyclohex-2-ene-1-carboxylate (PubChem CID 102125512) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl (1S,4S,5R,6R)-4,6-diacetyloxy-5-phenylmethoxycyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1S,4S,5R,6R)-4,6-diacetyloxy-5-phenylmethoxycyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102125512 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | ethyl (1S,4S,5R,6R)-4,6-diacetyloxy-5-phenylmethoxycyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=CC(OC(C)=O)[C@@H](OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H24O7/c1-4-24-20(23)16-10-11-17(26-13(2)21)19(18(16)27-14(3)22)25-12-15-8-6-5-7-9-15/h5-11,16-19H,4,12H2,1-3H3/t16-,17?,18+,19+/m0/s1 |
| InChIKey | LWEQTYOKBJRYKB-GCWMRRSQSA-N |
| XLogP | 2.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|