C15H18O5 — CID 10945763
[(1R,4R,5S,6R)-4,5-dihydroxy-6-phenylmethoxycyclohex-2-en-1-yl] acetate (PubChem CID 10945763) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is [(1R,4R,5S,6R)-4,5-dihydroxy-6-phenylmethoxycyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4R,5S,6R)-4,5-dihydroxy-6-phenylmethoxycyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10945763 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [(1R,4R,5S,6R)-4,5-dihydroxy-6-phenylmethoxycyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H](O)[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H18O5/c1-10(16)20-13-8-7-12(17)14(18)15(13)19-9-11-5-3-2-4-6-11/h2-8,12-15,17-18H,9H2,1H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | JCNVPALSSDXMGJ-KBXIAJHMSA-N |
| XLogP | 0.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|