C28H34N2O6 — CID 15527452
[(1R,2S,3R,4S,5R,6S)-5-acetyloxy-7,8-dimethyl-3,4-bis(phenylmethoxy)-7,8-diazabicyclo[4.2.2]dec-9-en-2-yl] acetate (PubChem CID 15527452) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5R,6S)-5-acetyloxy-7,8-dimethyl-3,4-bis(phenylmethoxy)-7,8-diazabicyclo[4.2.2]dec-9-en-2-yl] acetate.
| Compound Name | [(1R,2S,3R,4S,5R,6S)-5-acetyloxy-7,8-dimethyl-3,4-bis(phenylmethoxy)-7,8-diazabicyclo[4.2.2]dec-9-en-2-yl] acetate |
|---|---|
| PubChem CID | 15527452 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | [(1R,2S,3R,4S,5R,6S)-5-acetyloxy-7,8-dimethyl-3,4-bis(phenylmethoxy)-7,8-diazabicyclo[4.2.2]dec-9-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OC(C)=O)[C@@H]2C=C[C@H]1N(C)N2C |
| InChI | InChI=1S/C28H34N2O6/c1-19(31)35-25-23-15-16-24(30(4)29(23)3)26(36-20(2)32)28(34-18-22-13-9-6-10-14-22)27(25)33-17-21-11-7-5-8-12-21/h5-16,23-28H,17-18H2,1-4H3/t23-,24+,25+,26-,27-,28+ |
| InChIKey | GERRCXJTIDFXCN-BYECRERDSA-N |
| XLogP | 3.12 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|