C30H42O5Si — CID 10553755
[(1R,4Z,6R,7R,8S)-7,8-bis(phenylmethoxy)-6-triethylsilyloxycyclooct-4-en-1-yl] acetate (PubChem CID 10553755) has the molecular formula C30H42O5Si and a molecular weight of 510.75 g/mol. Its IUPAC name is [(1R,4Z,6R,7R,8S)-7,8-bis(phenylmethoxy)-6-triethylsilyloxycyclooct-4-en-1-yl] acetate.
| Compound Name | [(1R,4Z,6R,7R,8S)-7,8-bis(phenylmethoxy)-6-triethylsilyloxycyclooct-4-en-1-yl] acetate |
|---|---|
| PubChem CID | 10553755 |
| Molecular Formula | C30H42O5Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | [(1R,4Z,6R,7R,8S)-7,8-bis(phenylmethoxy)-6-triethylsilyloxycyclooct-4-en-1-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1/C=C\CC[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H42O5Si/c1-5-36(6-2,7-3)35-28-21-15-14-20-27(34-24(4)31)29(32-22-25-16-10-8-11-17-25)30(28)33-23-26-18-12-9-13-19-26/h8-13,15-19,21,27-30H,5-7,14,20,22-23H2,1-4H3/b21-15-/t27-,28-,29+,30+/m1/s1 |
| InChIKey | NZKXHXVIKSUUSD-SAGFGKKISA-N |
| XLogP | 6.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|