C23H38O5 — CID 100962299
(2R,3R,4R,5R)-5-decyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-ol (PubChem CID 100962299) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-decyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-decyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-ol |
|---|---|
| PubChem CID | 100962299 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (2R,3R,4R,5R)-5-decyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-ol |
| SMILES | CCCCCCCCCC[C@H]1O[C@@H](OC)[C@H](O)[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H38O5/c1-4-5-6-7-8-9-10-11-12-20-22(21(24)23(26-3)28-20)27-17-18-13-15-19(25-2)16-14-18/h13-16,20-24H,4-12,17H2,1-3H3/t20-,21-,22+,23-/m1/s1 |
| InChIKey | IFHUZMLIEUBRLD-BXXSPATCSA-N |
| XLogP | 4.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|