C14H24O4 — CID 10890525
(2R,3R,4R,5R)-5-hexyl-2-methoxy-4-prop-2-ynoxyoxolan-3-ol (PubChem CID 10890525) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-hexyl-2-methoxy-4-prop-2-ynoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-hexyl-2-methoxy-4-prop-2-ynoxyoxolan-3-ol |
|---|---|
| PubChem CID | 10890525 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2R,3R,4R,5R)-5-hexyl-2-methoxy-4-prop-2-ynoxyoxolan-3-ol |
| SMILES | C#CCO[C@@H]1[C@@H](O)[C@H](OC)O[C@@H]1CCCCCC |
| InChI | InChI=1S/C14H24O4/c1-4-6-7-8-9-11-13(17-10-5-2)12(15)14(16-3)18-11/h2,11-15H,4,6-10H2,1,3H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | DSEIBGWFLTWDDW-YIYPIFLZSA-N |
| XLogP | 1.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|