C16H20O6 — CID 156689108
[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(prop-2-ynoxy)oxan-2-yl]methanol (PubChem CID 156689108) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(prop-2-ynoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(prop-2-ynoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 156689108 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(prop-2-ynoxy)oxan-2-yl]methanol |
| SMILES | C#CCO[C@@H]1[C@@H](OCC#C)[C@H](OC)O[C@H](CO)[C@H]1OCC#C |
| InChI | InChI=1S/C16H20O6/c1-5-8-19-13-12(11-17)22-16(18-4)15(21-10-7-3)14(13)20-9-6-2/h1-3,12-17H,8-11H2,4H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | CBWKHGLZRXBELX-IBEHDNSVSA-N |
| XLogP | -0.59 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|