C16H26O5 — CID 142493949
[(3R,4R,5R)-3-(cyclohexylmethoxy)-5-methoxy-4-prop-2-ynoxyoxolan-2-yl]methanol (PubChem CID 142493949) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(3R,4R,5R)-3-(cyclohexylmethoxy)-5-methoxy-4-prop-2-ynoxyoxolan-2-yl]methanol.
| Compound Name | [(3R,4R,5R)-3-(cyclohexylmethoxy)-5-methoxy-4-prop-2-ynoxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 142493949 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(3R,4R,5R)-3-(cyclohexylmethoxy)-5-methoxy-4-prop-2-ynoxyoxolan-2-yl]methanol |
| SMILES | C#CCO[C@H]1[C@H](OC)OC(CO)[C@H]1OCC1CCCCC1 |
| InChI | InChI=1S/C16H26O5/c1-3-9-19-15-14(13(10-17)21-16(15)18-2)20-11-12-7-5-4-6-8-12/h1,12-17H,4-11H2,2H3/t13?,14-,15-,16-/m1/s1 |
| InChIKey | NNNQSVGIRFKVAJ-VZMGZUMBSA-N |
| XLogP | 1.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|