C18H24O5 — CID 53467505
(2S,3S,4R,5R)-2-ethyl-5-methoxy-3-[(4-methoxyphenyl)methoxy]-4-prop-2-ynoxyoxolane (PubChem CID 53467505) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-ethyl-5-methoxy-3-[(4-methoxyphenyl)methoxy]-4-prop-2-ynoxyoxolane.
| Compound Name | (2S,3S,4R,5R)-2-ethyl-5-methoxy-3-[(4-methoxyphenyl)methoxy]-4-prop-2-ynoxyoxolane |
|---|---|
| PubChem CID | 53467505 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2S,3S,4R,5R)-2-ethyl-5-methoxy-3-[(4-methoxyphenyl)methoxy]-4-prop-2-ynoxyoxolane |
| SMILES | C#CCO[C@H]1[C@H](OC)O[C@@H](CC)[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24O5/c1-5-11-21-17-16(15(6-2)23-18(17)20-4)22-12-13-7-9-14(19-3)10-8-13/h1,7-10,15-18H,6,11-12H2,2-4H3/t15-,16-,17+,18+/m0/s1 |
| InChIKey | LLPMBEFTVTXTHT-WNRNVDISSA-N |
| XLogP | 2.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|