C17H24O3 — CID 130262553
(2R,3R,5R)-5-[(1R)-1-phenylmethoxypropyl]-2-prop-2-enyloxolan-3-ol (PubChem CID 130262553) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2R,3R,5R)-5-[(1R)-1-phenylmethoxypropyl]-2-prop-2-enyloxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-[(1R)-1-phenylmethoxypropyl]-2-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 130262553 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2R,3R,5R)-5-[(1R)-1-phenylmethoxypropyl]-2-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@H]1O[C@@H]([C@@H](CC)OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C17H24O3/c1-3-8-16-14(18)11-17(20-16)15(4-2)19-12-13-9-6-5-7-10-13/h3,5-7,9-10,14-18H,1,4,8,11-12H2,2H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | ISDHGHVMRUJZGU-QBPKDAKJSA-N |
| XLogP | 3.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|