C20H30O3 — CID 12003745
(4S,6R,7R)-7-[(2S,5R)-5-methyloxolan-2-yl]-6-phenylmethoxyoct-1-en-4-ol (PubChem CID 12003745) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4S,6R,7R)-7-[(2S,5R)-5-methyloxolan-2-yl]-6-phenylmethoxyoct-1-en-4-ol.
| Compound Name | (4S,6R,7R)-7-[(2S,5R)-5-methyloxolan-2-yl]-6-phenylmethoxyoct-1-en-4-ol |
|---|---|
| PubChem CID | 12003745 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4S,6R,7R)-7-[(2S,5R)-5-methyloxolan-2-yl]-6-phenylmethoxyoct-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H](OCc1ccccc1)[C@@H](C)[C@@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C20H30O3/c1-4-8-18(21)13-20(16(3)19-12-11-15(2)23-19)22-14-17-9-6-5-7-10-17/h4-7,9-10,15-16,18-21H,1,8,11-14H2,2-3H3/t15-,16+,18+,19+,20-/m1/s1 |
| InChIKey | BZCBIPPQKYEZPJ-XIHRTOKZSA-N |
| XLogP | 4.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|