C21H32O3 — CID 134833558
(2S)-1-[(2R,6S)-6-[(2S)-2-methyl-3-phenylmethoxypropyl]oxan-2-yl]pent-4-en-2-ol (PubChem CID 134833558) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (2S)-1-[(2R,6S)-6-[(2S)-2-methyl-3-phenylmethoxypropyl]oxan-2-yl]pent-4-en-2-ol.
| Compound Name | (2S)-1-[(2R,6S)-6-[(2S)-2-methyl-3-phenylmethoxypropyl]oxan-2-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 134833558 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (2S)-1-[(2R,6S)-6-[(2S)-2-methyl-3-phenylmethoxypropyl]oxan-2-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@H](O)C[C@H]1CCC[C@@H](C[C@H](C)COCc2ccccc2)O1 |
| InChI | InChI=1S/C21H32O3/c1-3-8-19(22)14-21-12-7-11-20(24-21)13-17(2)15-23-16-18-9-5-4-6-10-18/h3-6,9-10,17,19-22H,1,7-8,11-16H2,2H3/t17-,19-,20-,21+/m0/s1 |
| InChIKey | QBKCQFNUUNTCHQ-ZIBCJSCZSA-N |
| XLogP | 4.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|