C18H26O3 — CID 101171403
(2S,6S)-6-ethoxy-2-[(2R)-2-methyl-3-phenylmethoxypropyl]-3,6-dihydro-2H-pyran (PubChem CID 101171403) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2S,6S)-6-ethoxy-2-[(2R)-2-methyl-3-phenylmethoxypropyl]-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6S)-6-ethoxy-2-[(2R)-2-methyl-3-phenylmethoxypropyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 101171403 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2S,6S)-6-ethoxy-2-[(2R)-2-methyl-3-phenylmethoxypropyl]-3,6-dihydro-2H-pyran |
| SMILES | CCO[C@@H]1C=CC[C@@H](C[C@@H](C)COCc2ccccc2)O1 |
| InChI | InChI=1S/C18H26O3/c1-3-20-18-11-7-10-17(21-18)12-15(2)13-19-14-16-8-5-4-6-9-16/h4-9,11,15,17-18H,3,10,12-14H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | BGGAMGBVGGTUER-NJAFHUGGSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|