C23H32O4 — CID 11451580
ethyl (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-phenylmethoxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentanoate (PubChem CID 11451580) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethyl (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-phenylmethoxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentanoate.
| Compound Name | ethyl (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-phenylmethoxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentanoate |
|---|---|
| PubChem CID | 11451580 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-phenylmethoxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentanoate |
| SMILES | C=C(C[C@H](C)C[C@@H]1CC=C[C@@H](CCOCc2ccccc2)O1)C(=O)OCC |
| InChI | InChI=1S/C23H32O4/c1-4-26-23(24)19(3)15-18(2)16-22-12-8-11-21(27-22)13-14-25-17-20-9-6-5-7-10-20/h5-11,18,21-22H,3-4,12-17H2,1-2H3/t18-,21-,22-/m0/s1 |
| InChIKey | XEHPMLLRNZBEMH-NYVOZVTQSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|