C14H18O — CID 56837491
(2S,6R)-6-benzyl-2-ethyl-3,6-dihydro-2H-pyran (PubChem CID 56837491) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (2S,6R)-6-benzyl-2-ethyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6R)-6-benzyl-2-ethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 56837491 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (2S,6R)-6-benzyl-2-ethyl-3,6-dihydro-2H-pyran |
| SMILES | CC[C@H]1CC=C[C@@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H18O/c1-2-13-9-6-10-14(15-13)11-12-7-4-3-5-8-12/h3-8,10,13-14H,2,9,11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | ASJUKHPSAJIBIA-KBPBESRZSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|