C20H21BrO — CID 56837860
(2S,6R)-6-[(4-bromophenyl)methyl]-2-(2-phenylethyl)-3,6-dihydro-2H-pyran (PubChem CID 56837860) has the molecular formula C20H21BrO and a molecular weight of 357.29 g/mol. Its IUPAC name is (2S,6R)-6-[(4-bromophenyl)methyl]-2-(2-phenylethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6R)-6-[(4-bromophenyl)methyl]-2-(2-phenylethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 56837860 |
| Molecular Formula | C20H21BrO |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2S,6R)-6-[(4-bromophenyl)methyl]-2-(2-phenylethyl)-3,6-dihydro-2H-pyran |
| SMILES | Brc1ccc(C[C@@H]2C=CC[C@H](CCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H21BrO/c21-18-12-9-17(10-13-18)15-20-8-4-7-19(22-20)14-11-16-5-2-1-3-6-16/h1-6,8-10,12-13,19-20H,7,11,14-15H2/t19-,20+/m1/s1 |
| InChIKey | PHXIVIZGADPEQI-UXHICEINSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|