C22H26O4S — CID 134928860
[(2R,6R)-2-benzyl-3,6-dihydro-2H-pyran-6-yl]methyl 2,4,6-trimethylbenzenesulfonate (PubChem CID 134928860) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is [(2R,6R)-2-benzyl-3,6-dihydro-2H-pyran-6-yl]methyl 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2R,6R)-2-benzyl-3,6-dihydro-2H-pyran-6-yl]methyl 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 134928860 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [(2R,6R)-2-benzyl-3,6-dihydro-2H-pyran-6-yl]methyl 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)OC[C@H]2C=CC[C@H](Cc3ccccc3)O2)c(C)c1 |
| InChI | InChI=1S/C22H26O4S/c1-16-12-17(2)22(18(3)13-16)27(23,24)25-15-21-11-7-10-20(26-21)14-19-8-5-4-6-9-19/h4-9,11-13,20-21H,10,14-15H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | BTFDVWBHTQPEQO-NHCUHLMSSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|