About ethane;bis(2-ethyloxirane);3-phenylpropylbenzene
ethane;bis(2-ethyloxirane);3-phenylpropylbenzene (PubChem CID 159337252) has the molecular formula C27H44O2
and a molecular weight of 400.65 g/mol. Its IUPAC name is ethane;bis(2-ethyloxirane);3-phenylpropylbenzene.
Molecular Properties
| Compound Name | ethane;bis(2-ethyloxirane);3-phenylpropylbenzene |
| PubChem CID | 159337252 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | ethane;bis(2-ethyloxirane);3-phenylpropylbenzene |
| SMILES | CC.CC.CCC1CO1.CCC1CO1.c1ccc(CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16.2C4H8O.2C2H6/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;2*1-2-4-3-5-4;2*1-2/h1-6,8-11H,7,12-13H2;2*4H,2-3H2,1H3;2*1-2H3 |
| InChIKey | LFRSQHFNZGINFH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;bis(2-ethyloxirane);3-phenylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;bis(2-ethyloxirane);3-phenylpropylbenzene?
The IUPAC name of ethane;bis(2-ethyloxirane);3-phenylpropylbenzene (CID 159337252) is ethane;bis(2-ethyloxirane);3-phenylpropylbenzene.
What is the SMILES notation for ethane;bis(2-ethyloxirane);3-phenylpropylbenzene?
The canonical SMILES for ethane;bis(2-ethyloxirane);3-phenylpropylbenzene is CC.CC.CCC1CO1.CCC1CO1.c1ccc(CCCc2ccccc2)cc1.
What is the InChIKey of ethane;bis(2-ethyloxirane);3-phenylpropylbenzene?
The InChIKey is LFRSQHFNZGINFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.2C4H8O.2C2H6/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;2*1-2-4-3-5-4;2*1-2/h1-6,8-11H,7,12-13H2;2*4H,2-3H2,1H3;2*1-2H3.
What are the key properties of ethane;bis(2-ethyloxirane);3-phenylpropylbenzene?
ethane;bis(2-ethyloxirane);3-phenylpropylbenzene has a molecular weight of 400.65 g/mol, XLogP of 7.50, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;bis(2-ethyloxirane);3-phenylpropylbenzene is sourced from PubChem (CID 159337252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).