C13H18O2 — CID 100963956
2-(3-phenylpropyl)-1,4-dioxane (PubChem CID 100963956) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(3-phenylpropyl)-1,4-dioxane.
| Compound Name | 2-(3-phenylpropyl)-1,4-dioxane |
|---|---|
| PubChem CID | 100963956 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(3-phenylpropyl)-1,4-dioxane |
| SMILES | c1ccc(CCCC2COCCO2)cc1 |
| InChI | InChI=1S/C13H18O2/c1-2-5-12(6-3-1)7-4-8-13-11-14-9-10-15-13/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | BFXVNLPYQNLKCP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |