C18H28N2O2 — CID 138806270
1-[2-(1,4-dioxan-2-yl)ethyl]-4-(2-phenylethyl)piperazine (PubChem CID 138806270) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[2-(1,4-dioxan-2-yl)ethyl]-4-(2-phenylethyl)piperazine.
| Compound Name | 1-[2-(1,4-dioxan-2-yl)ethyl]-4-(2-phenylethyl)piperazine |
|---|---|
| PubChem CID | 138806270 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[2-(1,4-dioxan-2-yl)ethyl]-4-(2-phenylethyl)piperazine |
| SMILES | c1ccc(CCN2CCN(CCC3COCCO3)CC2)cc1 |
| InChI | InChI=1S/C18H28N2O2/c1-2-4-17(5-3-1)6-8-19-10-12-20(13-11-19)9-7-18-16-21-14-15-22-18/h1-5,18H,6-16H2 |
| InChIKey | QEJSBDCTRQIUIU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |