C21H33NO4 — CID 154919917
1-[2-(1,4-dioxan-2-yl)ethyl]-4-(3-phenylpropyl)piperidine;formic acid (PubChem CID 154919917) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[2-(1,4-dioxan-2-yl)ethyl]-4-(3-phenylpropyl)piperidine;formic acid.
| Compound Name | 1-[2-(1,4-dioxan-2-yl)ethyl]-4-(3-phenylpropyl)piperidine;formic acid |
|---|---|
| PubChem CID | 154919917 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[2-(1,4-dioxan-2-yl)ethyl]-4-(3-phenylpropyl)piperidine;formic acid |
| SMILES | O=CO.c1ccc(CCCC2CCN(CCC3COCCO3)CC2)cc1 |
| InChI | InChI=1S/C20H31NO2.CH2O2/c1-2-5-18(6-3-1)7-4-8-19-9-12-21(13-10-19)14-11-20-17-22-15-16-23-20;2-1-3/h1-3,5-6,19-20H,4,7-17H2;1H,(H,2,3) |
| InChIKey | DWELYAKCSZRVSM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|