C15H22OS2 — CID 10517049
2-[(2R)-2-methyl-3-phenylmethoxypropyl]-1,3-dithiane (PubChem CID 10517049) has the molecular formula C15H22OS2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-[(2R)-2-methyl-3-phenylmethoxypropyl]-1,3-dithiane.
| Compound Name | 2-[(2R)-2-methyl-3-phenylmethoxypropyl]-1,3-dithiane |
|---|---|
| PubChem CID | 10517049 |
| Molecular Formula | C15H22OS2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[(2R)-2-methyl-3-phenylmethoxypropyl]-1,3-dithiane |
| SMILES | C[C@@H](COCc1ccccc1)CC1SCCCS1 |
| InChI | InChI=1S/C15H22OS2/c1-13(10-15-17-8-5-9-18-15)11-16-12-14-6-3-2-4-7-14/h2-4,6-7,13,15H,5,8-12H2,1H3/t13-/m1/s1 |
| InChIKey | JMKQHBGPQWAOLH-CYBMUJFWSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |