C34H38OS2Si — CID 11444288
(2-benzyl-1,3-dithian-2-yl)-[(2R)-2-methyl-3-phenylmethoxypropyl]-diphenylsilane (PubChem CID 11444288) has the molecular formula C34H38OS2Si and a molecular weight of 554.90 g/mol. Its IUPAC name is (2-benzyl-1,3-dithian-2-yl)-[(2R)-2-methyl-3-phenylmethoxypropyl]-diphenylsilane.
| Compound Name | (2-benzyl-1,3-dithian-2-yl)-[(2R)-2-methyl-3-phenylmethoxypropyl]-diphenylsilane |
|---|---|
| PubChem CID | 11444288 |
| Molecular Formula | C34H38OS2Si |
| Molecular Weight | 554.90 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | (2-benzyl-1,3-dithian-2-yl)-[(2R)-2-methyl-3-phenylmethoxypropyl]-diphenylsilane |
| SMILES | C[C@H](COCc1ccccc1)C[Si](c1ccccc1)(c1ccccc1)C1(Cc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C34H38OS2Si/c1-29(26-35-27-31-17-8-3-9-18-31)28-38(32-19-10-4-11-20-32,33-21-12-5-13-22-33)34(36-23-14-24-37-34)25-30-15-6-2-7-16-30/h2-13,15-22,29H,14,23-28H2,1H3/t29-/m1/s1 |
| InChIKey | ZWQICTDKIJBCTH-GDLZYMKVSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.90 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|