C21H28OSi — CID 15316565
dimethyl-[(E,4R)-4-methyl-5-phenylmethoxypent-2-enyl]-phenylsilane (PubChem CID 15316565) has the molecular formula C21H28OSi and a molecular weight of 324.54 g/mol. Its IUPAC name is dimethyl-[(E,4R)-4-methyl-5-phenylmethoxypent-2-enyl]-phenylsilane.
| Compound Name | dimethyl-[(E,4R)-4-methyl-5-phenylmethoxypent-2-enyl]-phenylsilane |
|---|---|
| PubChem CID | 15316565 |
| Molecular Formula | C21H28OSi |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | dimethyl-[(E,4R)-4-methyl-5-phenylmethoxypent-2-enyl]-phenylsilane |
| SMILES | C[C@H](/C=C/C[Si](C)(C)c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C21H28OSi/c1-19(17-22-18-20-12-6-4-7-13-20)11-10-16-23(2,3)21-14-8-5-9-15-21/h4-15,19H,16-18H2,1-3H3/b11-10+/t19-/m1/s1 |
| InChIKey | JZNVCGQNAGVAQV-GNISGLHKSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|