C27H35NO3 — CID 14788306
(2R)-1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]-2-methylpent-4-en-1-one (PubChem CID 14788306) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is (2R)-1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]-2-methylpent-4-en-1-one.
| Compound Name | (2R)-1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]-2-methylpent-4-en-1-one |
|---|---|
| PubChem CID | 14788306 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (2R)-1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]-2-methylpent-4-en-1-one |
| SMILES | C=CC[C@@H](C)C(=O)N1[C@@H](COCc2ccccc2)CCC[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C27H35NO3/c1-3-11-22(2)27(29)28-25(20-30-18-23-12-6-4-7-13-23)16-10-17-26(28)21-31-19-24-14-8-5-9-15-24/h3-9,12-15,22,25-26H,1,10-11,16-21H2,2H3/t22-,25-,26-/m1/s1 |
| InChIKey | JDPREDJCWQJMRY-DNRSQYFGSA-N |
| XLogP | 5.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|