C24H31NO3 — CID 10022740
1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]propan-1-one (PubChem CID 10022740) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]propan-1-one.
| Compound Name | 1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 10022740 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 1-[(2R,6R)-2,6-bis(phenylmethoxymethyl)piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1[C@@H](COCc2ccccc2)CCC[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C24H31NO3/c1-2-24(26)25-22(18-27-16-20-10-5-3-6-11-20)14-9-15-23(25)19-28-17-21-12-7-4-8-13-21/h3-8,10-13,22-23H,2,9,14-19H2,1H3/t22-,23-/m1/s1 |
| InChIKey | AUEDDCXWHDVZHH-DHIUTWEWSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |