C18H25NO3 — CID 102080852
methyl (2R,3R)-2-cyclohexyl-3-(phenylmethoxymethyl)aziridine-1-carboxylate (PubChem CID 102080852) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl (2R,3R)-2-cyclohexyl-3-(phenylmethoxymethyl)aziridine-1-carboxylate.
| Compound Name | methyl (2R,3R)-2-cyclohexyl-3-(phenylmethoxymethyl)aziridine-1-carboxylate |
|---|---|
| PubChem CID | 102080852 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | methyl (2R,3R)-2-cyclohexyl-3-(phenylmethoxymethyl)aziridine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](C2CCCCC2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c1-21-18(20)19-16(17(19)15-10-6-3-7-11-15)13-22-12-14-8-4-2-5-9-14/h2,4-5,8-9,15-17H,3,6-7,10-13H2,1H3/t16-,17+,19?/m0/s1 |
| InChIKey | AMEVVRPBMPMCTG-PZEDNMLSSA-N |
| XLogP | 3.60 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|