C18H25NO3 — CID 139261982
methyl (E)-3-cyclohexyl-2-[(phenylmethoxyamino)methyl]prop-2-enoate (PubChem CID 139261982) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl (E)-3-cyclohexyl-2-[(phenylmethoxyamino)methyl]prop-2-enoate.
| Compound Name | methyl (E)-3-cyclohexyl-2-[(phenylmethoxyamino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 139261982 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | methyl (E)-3-cyclohexyl-2-[(phenylmethoxyamino)methyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/C1CCCCC1)CNOCc1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c1-21-18(20)17(12-15-8-4-2-5-9-15)13-19-22-14-16-10-6-3-7-11-16/h3,6-7,10-12,15,19H,2,4-5,8-9,13-14H2,1H3/b17-12+ |
| InChIKey | MANMOMTUSIKICQ-SFQUDFHCSA-N |
| XLogP | 3.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|