C19H27O4P — CID 67805004
(E)-2-[[benzyl(ethoxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid (PubChem CID 67805004) has the molecular formula C19H27O4P and a molecular weight of 350.40 g/mol. Its IUPAC name is (E)-2-[[benzyl(ethoxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid.
| Compound Name | (E)-2-[[benzyl(ethoxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid |
|---|---|
| PubChem CID | 67805004 |
| Molecular Formula | C19H27O4P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-2-[[benzyl(ethoxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid |
| SMILES | CCOP(=O)(C/C(=C/C1CCCCC1)C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C19H27O4P/c1-2-23-24(22,14-17-11-7-4-8-12-17)15-18(19(20)21)13-16-9-5-3-6-10-16/h4,7-8,11-13,16H,2-3,5-6,9-10,14-15H2,1H3,(H,20,21)/b18-13- |
| InChIKey | UVGDBAYFPWHYGT-AQTBWJFISA-N |
| XLogP | 5.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|