C21H28O4 — CID 70354628
3-cyclohexyl-2-methylprop-2-enoic acid;2-methylidene-4-phenylbutanoic acid (PubChem CID 70354628) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 3-cyclohexyl-2-methylprop-2-enoic acid;2-methylidene-4-phenylbutanoic acid.
| Compound Name | 3-cyclohexyl-2-methylprop-2-enoic acid;2-methylidene-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 70354628 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-cyclohexyl-2-methylprop-2-enoic acid;2-methylidene-4-phenylbutanoic acid |
| SMILES | C=C(CCc1ccccc1)C(=O)O.CC(=CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C11H12O2.C10H16O2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10;1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6H,1,7-8H2,(H,12,13);7,9H,2-6H2,1H3,(H,11,12) |
| InChIKey | SAYVRGLZDODCNW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|