C19H26O4P+ — CID 67804824
(2-carboxy-3-cyclohexylprop-2-enyl)-oxo-(3-phenylpropoxy)phosphanium (PubChem CID 67804824) has the molecular formula C19H26O4P+ and a molecular weight of 349.39 g/mol. Its IUPAC name is (2-carboxy-3-cyclohexylprop-2-enyl)-oxo-(3-phenylpropoxy)phosphanium.
| Compound Name | (2-carboxy-3-cyclohexylprop-2-enyl)-oxo-(3-phenylpropoxy)phosphanium |
|---|---|
| PubChem CID | 67804824 |
| Molecular Formula | C19H26O4P+ |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2-carboxy-3-cyclohexylprop-2-enyl)-oxo-(3-phenylpropoxy)phosphanium |
| SMILES | O=C(O)C(=CC1CCCCC1)C[P+](=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C19H25O4P/c20-19(21)18(14-17-10-5-2-6-11-17)15-24(22)23-13-7-12-16-8-3-1-4-9-16/h1,3-4,8-9,14,17H,2,5-7,10-13,15H2/p+1 |
| InChIKey | UFWRGQVFEJBSPR-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|