C13H22O4P+ — CID 57294645
(2-carboxy-3-cyclohexylprop-2-enyl)-(2-hydroxypropan-2-yl)-oxophosphanium (PubChem CID 57294645) has the molecular formula C13H22O4P+ and a molecular weight of 273.29 g/mol. Its IUPAC name is (2-carboxy-3-cyclohexylprop-2-enyl)-(2-hydroxypropan-2-yl)-oxophosphanium.
| Compound Name | (2-carboxy-3-cyclohexylprop-2-enyl)-(2-hydroxypropan-2-yl)-oxophosphanium |
|---|---|
| PubChem CID | 57294645 |
| Molecular Formula | C13H22O4P+ |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2-carboxy-3-cyclohexylprop-2-enyl)-(2-hydroxypropan-2-yl)-oxophosphanium |
| SMILES | CC(C)(O)[P+](=O)CC(=CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C13H21O4P/c1-13(2,16)18(17)9-11(12(14)15)8-10-6-4-3-5-7-10/h8,10,16H,3-7,9H2,1-2H3/p+1 |
| InChIKey | OLFUSYIIYHYKPF-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|