C15H24O2 — CID 134924255
(4E)-4-(cyclohexylmethylidene)octane-3,6-dione (PubChem CID 134924255) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4E)-4-(cyclohexylmethylidene)octane-3,6-dione.
| Compound Name | (4E)-4-(cyclohexylmethylidene)octane-3,6-dione |
|---|---|
| PubChem CID | 134924255 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (4E)-4-(cyclohexylmethylidene)octane-3,6-dione |
| SMILES | CCC(=O)C/C(=C\C1CCCCC1)C(=O)CC |
| InChI | InChI=1S/C15H24O2/c1-3-14(16)11-13(15(17)4-2)10-12-8-6-5-7-9-12/h10,12H,3-9,11H2,1-2H3/b13-10+ |
| InChIKey | NIBWOTPZZGQMDM-JLHYYAGUSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|