About cyclohexyl 3,5-dioxoheptanoate
cyclohexyl 3,5-dioxoheptanoate (PubChem CID 139634399) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is cyclohexyl 3,5-dioxoheptanoate.
Molecular Properties
| Compound Name | cyclohexyl 3,5-dioxoheptanoate |
| PubChem CID | 139634399 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | cyclohexyl 3,5-dioxoheptanoate |
| SMILES | CCC(=O)CC(=O)CC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C13H20O4/c1-2-10(14)8-11(15)9-13(16)17-12-6-4-3-5-7-12/h12H,2-9H2,1H3 |
| InChIKey | KBGPKXDKJLYBJH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 3,5-dioxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3,5-dioxoheptanoate?
The IUPAC name of cyclohexyl 3,5-dioxoheptanoate (CID 139634399) is cyclohexyl 3,5-dioxoheptanoate.
What is the SMILES notation for cyclohexyl 3,5-dioxoheptanoate?
The canonical SMILES for cyclohexyl 3,5-dioxoheptanoate is CCC(=O)CC(=O)CC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 3,5-dioxoheptanoate?
The InChIKey is KBGPKXDKJLYBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-2-10(14)8-11(15)9-13(16)17-12-6-4-3-5-7-12/h12H,2-9H2,1H3.
What are the key properties of cyclohexyl 3,5-dioxoheptanoate?
cyclohexyl 3,5-dioxoheptanoate has a molecular weight of 240.30 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3,5-dioxoheptanoate is sourced from PubChem (CID 139634399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).