About cyclohexyl N-ethylcarbamate
cyclohexyl N-ethylcarbamate (PubChem CID 22978796) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is cyclohexyl N-ethylcarbamate.
Molecular Properties
| Compound Name | cyclohexyl N-ethylcarbamate |
| PubChem CID | 22978796 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | cyclohexyl N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C9H17NO2/c1-2-10-9(11)12-8-6-4-3-5-7-8/h8H,2-7H2,1H3,(H,10,11) |
| InChIKey | UQRBBLPNBOUERA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl N-ethylcarbamate?
The IUPAC name of cyclohexyl N-ethylcarbamate (CID 22978796) is cyclohexyl N-ethylcarbamate.
What is the SMILES notation for cyclohexyl N-ethylcarbamate?
The canonical SMILES for cyclohexyl N-ethylcarbamate is CCNC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl N-ethylcarbamate?
The InChIKey is UQRBBLPNBOUERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-10-9(11)12-8-6-4-3-5-7-8/h8H,2-7H2,1H3,(H,10,11).
What are the key properties of cyclohexyl N-ethylcarbamate?
cyclohexyl N-ethylcarbamate has a molecular weight of 171.24 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl N-ethylcarbamate is sourced from PubChem (CID 22978796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).