About cyclohexyl propanoate;dihydrochloride
cyclohexyl propanoate;dihydrochloride (PubChem CID 172803130) has the molecular formula C9H18Cl2O2
and a molecular weight of 229.15 g/mol. Its IUPAC name is cyclohexyl propanoate;dihydrochloride.
Molecular Properties
| Compound Name | cyclohexyl propanoate;dihydrochloride |
| PubChem CID | 172803130 |
| Molecular Formula | C9H18Cl2O2 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | cyclohexyl propanoate;dihydrochloride |
| SMILES | CCC(=O)OC1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C9H16O2.2ClH/c1-2-9(10)11-8-6-4-3-5-7-8;;/h8H,2-7H2,1H3;2*1H |
| InChIKey | RDIBHTBYUOEWKM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl propanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl propanoate;dihydrochloride?
The IUPAC name of cyclohexyl propanoate;dihydrochloride (CID 172803130) is cyclohexyl propanoate;dihydrochloride.
What is the SMILES notation for cyclohexyl propanoate;dihydrochloride?
The canonical SMILES for cyclohexyl propanoate;dihydrochloride is CCC(=O)OC1CCCCC1.Cl.Cl.
What is the InChIKey of cyclohexyl propanoate;dihydrochloride?
The InChIKey is RDIBHTBYUOEWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.2ClH/c1-2-9(10)11-8-6-4-3-5-7-8;;/h8H,2-7H2,1H3;2*1H.
What are the key properties of cyclohexyl propanoate;dihydrochloride?
cyclohexyl propanoate;dihydrochloride has a molecular weight of 229.15 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl propanoate;dihydrochloride is sourced from PubChem (CID 172803130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).