C28H38O4 — CID 102084350
diethyl (2E,9Z)-2,9-bis(cyclohexylmethylidene)deca-4,6-diynedioate (PubChem CID 102084350) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is diethyl (2E,9Z)-2,9-bis(cyclohexylmethylidene)deca-4,6-diynedioate.
| Compound Name | diethyl (2E,9Z)-2,9-bis(cyclohexylmethylidene)deca-4,6-diynedioate |
|---|---|
| PubChem CID | 102084350 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | diethyl (2E,9Z)-2,9-bis(cyclohexylmethylidene)deca-4,6-diynedioate |
| SMILES | CCOC(=O)/C(=C\C1CCCCC1)CC#CC#CC/C(=C\C1CCCCC1)C(=O)OCC |
| InChI | InChI=1S/C28H38O4/c1-3-31-27(29)25(21-23-15-9-7-10-16-23)19-13-5-6-14-20-26(28(30)32-4-2)22-24-17-11-8-12-18-24/h21-24H,3-4,7-12,15-20H2,1-2H3/b25-21-,26-22+ |
| InChIKey | LUQORENYSPKHAT-KOUJMYIZSA-N |
| XLogP | 5.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|