C16H30NO4P — CID 54408804
2-[[1-aminohexyl(hydroxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid (PubChem CID 54408804) has the molecular formula C16H30NO4P and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-[[1-aminohexyl(hydroxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid.
| Compound Name | 2-[[1-aminohexyl(hydroxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid |
|---|---|
| PubChem CID | 54408804 |
| Molecular Formula | C16H30NO4P |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-[[1-aminohexyl(hydroxy)phosphoryl]methyl]-3-cyclohexylprop-2-enoic acid |
| SMILES | CCCCCC(N)P(=O)(O)CC(=CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C16H30NO4P/c1-2-3-5-10-15(17)22(20,21)12-14(16(18)19)11-13-8-6-4-7-9-13/h11,13,15H,2-10,12,17H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | VSQHPNIUDBJVGT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|