C14H25O4P — CID 15735587
(Z)-3-cyclohexyl-2-[[hydroxy(2-methylpropyl)phosphoryl]methyl]prop-2-enoic acid (PubChem CID 15735587) has the molecular formula C14H25O4P and a molecular weight of 288.32 g/mol. Its IUPAC name is (Z)-3-cyclohexyl-2-[[hydroxy(2-methylpropyl)phosphoryl]methyl]prop-2-enoic acid.
| Compound Name | (Z)-3-cyclohexyl-2-[[hydroxy(2-methylpropyl)phosphoryl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15735587 |
| Molecular Formula | C14H25O4P |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (Z)-3-cyclohexyl-2-[[hydroxy(2-methylpropyl)phosphoryl]methyl]prop-2-enoic acid |
| SMILES | CC(C)CP(=O)(O)C/C(=C\C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C14H25O4P/c1-11(2)9-19(17,18)10-13(14(15)16)8-12-6-4-3-5-7-12/h8,11-12H,3-7,9-10H2,1-2H3,(H,15,16)(H,17,18)/b13-8+ |
| InChIKey | RCNSPZDCSGEQAQ-MDWZMJQESA-N |
| XLogP | 3.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|