C16H27O4P — CID 67804026
2-[[cyclohexylmethyl(ethoxy)phosphoryl]methyl]-3-cyclopropylprop-2-enoic acid (PubChem CID 67804026) has the molecular formula C16H27O4P and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-[[cyclohexylmethyl(ethoxy)phosphoryl]methyl]-3-cyclopropylprop-2-enoic acid.
| Compound Name | 2-[[cyclohexylmethyl(ethoxy)phosphoryl]methyl]-3-cyclopropylprop-2-enoic acid |
|---|---|
| PubChem CID | 67804026 |
| Molecular Formula | C16H27O4P |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[[cyclohexylmethyl(ethoxy)phosphoryl]methyl]-3-cyclopropylprop-2-enoic acid |
| SMILES | CCOP(=O)(CC(=CC1CC1)C(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C16H27O4P/c1-2-20-21(19,11-14-6-4-3-5-7-14)12-15(16(17)18)10-13-8-9-13/h10,13-14H,2-9,11-12H2,1H3,(H,17,18) |
| InChIKey | VVRHGIJRGTUUPA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|