C15H31O4P — CID 129364277
[1,1-diethoxyethyl(ethoxy)phosphoryl]methylcyclohexane (PubChem CID 129364277) has the molecular formula C15H31O4P and a molecular weight of 306.38 g/mol. Its IUPAC name is [1,1-diethoxyethyl(ethoxy)phosphoryl]methylcyclohexane.
| Compound Name | [1,1-diethoxyethyl(ethoxy)phosphoryl]methylcyclohexane |
|---|---|
| PubChem CID | 129364277 |
| Molecular Formula | C15H31O4P |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | [1,1-diethoxyethyl(ethoxy)phosphoryl]methylcyclohexane |
| SMILES | CCOC(C)(OCC)[P@](=O)(CC1CCCCC1)OCC |
| InChI | InChI=1S/C15H31O4P/c1-5-17-15(4,18-6-2)20(16,19-7-3)13-14-11-9-8-10-12-14/h14H,5-13H2,1-4H3/t20-/m0/s1 |
| InChIKey | IMWDKPYYQXBYOC-FQEVSTJZSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|