C12H26NO3P — CID 10061302
(2S)-1-amino-3-[cyclohexylmethyl(ethoxy)phosphoryl]propan-2-ol (PubChem CID 10061302) has the molecular formula C12H26NO3P and a molecular weight of 263.32 g/mol. Its IUPAC name is (2S)-1-amino-3-[cyclohexylmethyl(ethoxy)phosphoryl]propan-2-ol.
| Compound Name | (2S)-1-amino-3-[cyclohexylmethyl(ethoxy)phosphoryl]propan-2-ol |
|---|---|
| PubChem CID | 10061302 |
| Molecular Formula | C12H26NO3P |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (2S)-1-amino-3-[cyclohexylmethyl(ethoxy)phosphoryl]propan-2-ol |
| SMILES | CCOP(=O)(CC1CCCCC1)C[C@@H](O)CN |
| InChI | InChI=1S/C12H26NO3P/c1-2-16-17(15,10-12(14)8-13)9-11-6-4-3-5-7-11/h11-12,14H,2-10,13H2,1H3/t12-,17?/m0/s1 |
| InChIKey | YNSMUXOBANLSIJ-WHUIICBVSA-N |
| XLogP | 2.20 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|