C11H24NO2P — CID 59011201
(2R)-1-amino-3-[cyclohexylmethyl(methyl)phosphoryl]propan-2-ol (PubChem CID 59011201) has the molecular formula C11H24NO2P and a molecular weight of 233.29 g/mol. Its IUPAC name is (2R)-1-amino-3-[cyclohexylmethyl(methyl)phosphoryl]propan-2-ol.
| Compound Name | (2R)-1-amino-3-[cyclohexylmethyl(methyl)phosphoryl]propan-2-ol |
|---|---|
| PubChem CID | 59011201 |
| Molecular Formula | C11H24NO2P |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (2R)-1-amino-3-[cyclohexylmethyl(methyl)phosphoryl]propan-2-ol |
| SMILES | CP(=O)(CC1CCCCC1)C[C@H](O)CN |
| InChI | InChI=1S/C11H24NO2P/c1-15(14,9-11(13)7-12)8-10-5-3-2-4-6-10/h10-11,13H,2-9,12H2,1H3/t11-,15?/m1/s1 |
| InChIKey | JABCJUKJUPPHNO-ZRKZCGFPSA-N |
| XLogP | 1.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|