C16H33AsNO4P — CID 172997238
[(2R)-3-[[(2S)-2-arsanyl-4-methylpentanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid (PubChem CID 172997238) has the molecular formula C16H33AsNO4P and a molecular weight of 409.34 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2-arsanyl-4-methylpentanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid.
| Compound Name | [(2R)-3-[[(2S)-2-arsanyl-4-methylpentanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
|---|---|
| PubChem CID | 172997238 |
| Molecular Formula | C16H33AsNO4P |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [(2R)-3-[[(2S)-2-arsanyl-4-methylpentanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
| SMILES | CC(C)CC([AsH2])C(=O)NC[C@@H](O)CP(=O)(O)CC1CCCCC1 |
| InChI | InChI=1S/C16H33AsNO4P/c1-12(2)8-15(17)16(20)18-9-14(19)11-23(21,22)10-13-6-4-3-5-7-13/h12-15,19H,3-11,17H2,1-2H3,(H,18,20)(H,21,22)/t14-,15?/m1/s1 |
| InChIKey | RTJOMWDGDZJGCX-GICMACPYSA-N |
| XLogP | 1.78 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|