C31H53N4O6P — CID 69249866
[(2R)-3-[[(2S)-2-(N-[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoyl]anilino)-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid (PubChem CID 69249866) has the molecular formula C31H53N4O6P and a molecular weight of 608.76 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2-(N-[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoyl]anilino)-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid.
| Compound Name | [(2R)-3-[[(2S)-2-(N-[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoyl]anilino)-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
|---|---|
| PubChem CID | 69249866 |
| Molecular Formula | C31H53N4O6P |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | [(2R)-3-[[(2S)-2-(N-[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoyl]anilino)-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@H](C(=O)N(c1ccccc1)[C@H](C(=O)NC[C@@H](O)CP(=O)(O)CC1CCCCC1)C(C)C)C(C)C |
| InChI | InChI=1S/C31H53N4O6P/c1-20(2)26(32)29(37)34-27(21(3)4)31(39)35(24-15-11-8-12-16-24)28(22(5)6)30(38)33-17-25(36)19-42(40,41)18-23-13-9-7-10-14-23/h8,11-12,15-16,20-23,25-28,36H,7,9-10,13-14,17-19,32H2,1-6H3,(H,33,38)(H,34,37)(H,40,41)/t25-,26+,27+,28+/m1/s1 |
| InChIKey | TZQQGLKUMUKACV-UNFRKHOWSA-N |
| XLogP | 3.50 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|