C15H31N2O4P — CID 11573547
[(2R)-3-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid (PubChem CID 11573547) has the molecular formula C15H31N2O4P and a molecular weight of 334.40 g/mol. Its IUPAC name is [(2R)-3-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid.
| Compound Name | [(2R)-3-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
|---|---|
| PubChem CID | 11573547 |
| Molecular Formula | C15H31N2O4P |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [(2R)-3-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
| SMILES | CC(C)[C@@H](N)C(=O)NC[C@@H](O)CP(=O)(O)CC1CCCCC1 |
| InChI | InChI=1S/C15H31N2O4P/c1-11(2)14(16)15(19)17-8-13(18)10-22(20,21)9-12-6-4-3-5-7-12/h11-14,18H,3-10,16H2,1-2H3,(H,17,19)(H,20,21)/t13-,14-/m1/s1 |
| InChIKey | LHUQHUKZXJNMIB-ZIAGYGMSSA-N |
| XLogP | 1.30 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|