C14H28NO4P — CID 159076279
[(2R,6S)-6-amino-2-hydroxy-5-oxoheptyl]-(cyclohexylmethyl)phosphinic acid (PubChem CID 159076279) has the molecular formula C14H28NO4P and a molecular weight of 305.35 g/mol. Its IUPAC name is [(2R,6S)-6-amino-2-hydroxy-5-oxoheptyl]-(cyclohexylmethyl)phosphinic acid.
| Compound Name | [(2R,6S)-6-amino-2-hydroxy-5-oxoheptyl]-(cyclohexylmethyl)phosphinic acid |
|---|---|
| PubChem CID | 159076279 |
| Molecular Formula | C14H28NO4P |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [(2R,6S)-6-amino-2-hydroxy-5-oxoheptyl]-(cyclohexylmethyl)phosphinic acid |
| SMILES | C[C@H](N)C(=O)CC[C@@H](O)CP(=O)(O)CC1CCCCC1 |
| InChI | InChI=1S/C14H28NO4P/c1-11(15)14(17)8-7-13(16)10-20(18,19)9-12-5-3-2-4-6-12/h11-13,16H,2-10,15H2,1H3,(H,18,19)/t11-,13+/m0/s1 |
| InChIKey | KAHFWVINSMWYKU-WCQYABFASA-N |
| XLogP | 1.89 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|