C22H40NO5P — CID 157334887
cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-7-methyl-5-oxooctyl]phosphinic acid (PubChem CID 157334887) has the molecular formula C22H40NO5P and a molecular weight of 429.54 g/mol. Its IUPAC name is cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-7-methyl-5-oxooctyl]phosphinic acid.
| Compound Name | cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-7-methyl-5-oxooctyl]phosphinic acid |
|---|---|
| PubChem CID | 157334887 |
| Molecular Formula | C22H40NO5P |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-7-methyl-5-oxooctyl]phosphinic acid |
| SMILES | CC(C)[C@H](NC(=O)C1CCCC1)C(=O)CC[C@@H](O)CP(=O)(O)CC1CCCCC1 |
| InChI | InChI=1S/C22H40NO5P/c1-16(2)21(23-22(26)18-10-6-7-11-18)20(25)13-12-19(24)15-29(27,28)14-17-8-4-3-5-9-17/h16-19,21,24H,3-15H2,1-2H3,(H,23,26)(H,27,28)/t19-,21+/m1/s1 |
| InChIKey | BFSMXAPOMWANQU-CTNGQTDRSA-N |
| XLogP | 3.88 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|