C26H40NO5P — CID 160567460
cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-5-oxo-7-phenylheptyl]phosphinic acid (PubChem CID 160567460) has the molecular formula C26H40NO5P and a molecular weight of 477.58 g/mol. Its IUPAC name is cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-5-oxo-7-phenylheptyl]phosphinic acid.
| Compound Name | cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-5-oxo-7-phenylheptyl]phosphinic acid |
|---|---|
| PubChem CID | 160567460 |
| Molecular Formula | C26H40NO5P |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | cyclohexylmethyl-[(2R,6S)-6-(cyclopentanecarbonylamino)-2-hydroxy-5-oxo-7-phenylheptyl]phosphinic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)CC[C@@H](O)CP(=O)(O)CC1CCCCC1)C1CCCC1 |
| InChI | InChI=1S/C26H40NO5P/c28-23(19-33(31,32)18-21-11-5-2-6-12-21)15-16-25(29)24(17-20-9-3-1-4-10-20)27-26(30)22-13-7-8-14-22/h1,3-4,9-10,21-24,28H,2,5-8,11-19H2,(H,27,30)(H,31,32)/t23-,24+/m1/s1 |
| InChIKey | RACNIDBHMBWUMD-RPWUZVMVSA-N |
| XLogP | 4.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|